3,4-difluoro-5-nitrobenzonitrile
$300.00
CAS No.: 1119454-07-7
Catalog No.: 190524
Purity: 95%
MF: C7H2F2N2O2
MW: 184.101
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C#N)C=C(C1F)[N+](=O)[O-]
Catalog No.: 190524
Purity: 95%
MF: C7H2F2N2O2
MW: 184.101
Storage: 2-8 degree Celsius
SMILES: FC=1C=C(C#N)C=C(C1F)[N+](=O)[O-]
3,4-difluoro-5-nitrobenzonitrile; CAS No.: 1119454-07-7; 3,4-difluoro-5-nitrobenzonitrile. As a chemical synthesis company, ChemShuttle specializes in offering diverse Screening compounds, including 3,4-difluoro-5-nitrobenzonitrile (CAS No.: 1119454-07-7). This compound is a key intermediate in the synthesis of various pharmaceuticals and specialty chemicals. ChemShuttle s custom synthesis services allow for the production of such specialized compounds, meeting the specific needs of clients in the chemical and pharmaceutical industries. The company s expertise in chemical synthesis ensures high-quality and efficient production of these essential building blocks for various applications.
Reviews
Write Your Own Review