1-(anthracen-9-yl)ethan-1-one

1-(anthracen-9-yl)ethan-1-one

2-phenylacetophenone

2-phenylacetophenone

3,4-bis(cyclopropylmethoxy)benzoic acid

$300.00
CAS No.: 1369851-30-8
Catalog No.: 194196
Purity: 95%
MF: C15H18O4
MW: 262.305
Storage: 2-8 degree Celsius
SMILES: C1(CC1)COC=1C=C(C(=O)O)C=CC1OCC1CC1
Availability:
In stock
SKU
194196
  • Size
    Price
    Stock
    Estimated Shipping Time
3,4-bis(cyclopropylmethoxy)benzoic acid; CAS No.: 1369851-30-8; 3,4-bis(cyclopropylmethoxy)benzoic acid. PROPERTIES: 3,4-bis(cyclopropylmethoxy)benzoic acid is a crystalline solid. Its molecular formula is C15H18O4, and the molecular weight is approximately 262.30 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing two cyclopropylmethoxy groups and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 3,4-bis(cyclopropylmethoxy)benzoic acid serves as a valuable intermediate. The carboxylic acid group can undergo reactions such as esterification and amidation. The cyclopropylmethoxy groups provide unique steric and electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 3,4-bis(cyclopropylmethoxy)benzoic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3,4-bis(cyclopropylmethoxy)benzoic acid
Your Rating