3,4-bis(cyclopropylmethoxy)benzoic acid

3,4-bis(cyclopropylmethoxy)benzoic acid

1,2-diphenyl-1-ethanone oxime

1,2-diphenyl-1-ethanone oxime

2-phenylacetophenone

$200.00
CAS No.: 451-40-1
Catalog No.: 194195
Purity: 95%
MF: C14H12O
MW: 196.249
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)CC(=O)C1=CC=CC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194195
  • Size
    Price
    Stock
    Estimated Shipping Time
2-phenylacetophenone; CAS No.: 451-40-1; 2-phenylacetophenone. PROPERTIES: 2-phenylacetophenone is a crystalline solid. Its molecular formula is C13H12O, and the molecular weight is approximately 184.23 g/mol. The compound has a melting point of approximately 40-42 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a ketone group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2-phenylacetophenone serves as a versatile intermediate. The ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of 2-phenylacetophenone can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:2-phenylacetophenone
Your Rating