2-hydroxy-5-nitrobenzonitrile
$300.00
CAS No.: 39835-09-1
Catalog No.: 189276
Purity: 95%
MF: C7H4N2O3
MW: 164.12
Storage: 2-8 degree Celsius
SMILES: OC1=C(C#N)C=C(C=C1)[N+](=O)[O-]
Catalog No.: 189276
Purity: 95%
MF: C7H4N2O3
MW: 164.12
Storage: 2-8 degree Celsius
SMILES: OC1=C(C#N)C=C(C=C1)[N+](=O)[O-]
2-hydroxy-5-nitrobenzonitrile; CAS No.: 39835-09-1; 2-hydroxy-5-nitrobenzonitrile exemplifies the hydroxynitrobenzonitrile category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to benzonitrile derivatives with hydroxy and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its hydroxy and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that 2-hydroxy-5-nitrobenzonitrile is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review