1-(bromomethyl)-2-chloro-3-(trifluoromethyl)benzene
$300.00
CAS No.: 261763-22-8
Catalog No.: 189277
Purity: 95%
MF: C8H5BrClF3
MW: 273.479
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C(=CC=C1)C(F)(F)F)Cl
Catalog No.: 189277
Purity: 95%
MF: C8H5BrClF3
MW: 273.479
Storage: 2-8 degree Celsius
SMILES: BrCC1=C(C(=CC=C1)C(F)(F)F)Cl
1-(bromomethyl)-2-chloro-3-(trifluoromethyl)benzene; CAS No.: 261763-22-8; 1-(bromomethyl)-2-chloro-3-(trifluoromethyl)benzene is one of the many bromomethyl-substituted aromatic compounds available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to benzene derivatives with bromomethyl, chloro, and trifluoromethyl substituents that are essential for the synthesis of various pharmaceuticals, materials, and agrochemicals. This compound, with its bromomethyl, chloro, and trifluoromethyl groups, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity 1-(bromomethyl)-2-chloro-3-(trifluoromethyl)benzene, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review