2-chloro-4-(trifluoromethoxy)bromobenzene
$250.00
CAS No.: 892845-59-9
Catalog No.: 197203
Purity: 95%
MF: C7H3BrClF3O
MW: 275.451
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC(=C1)OC(F)(F)F)Br
Catalog No.: 197203
Purity: 95%
MF: C7H3BrClF3O
MW: 275.451
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=CC(=C1)OC(F)(F)F)Br
2-chloro-4-(trifluoromethoxy)bromobenzene; CAS No.: 892845-59-9; 2-chloro-4-(trifluoromethoxy)bromobenzene. PROPERTIES: This chloro-trifluoromethoxy-bromo-substituted benzene features molecular formula C?H?BrClF?O with molecular weight 255.44 g/mol. It generally appears as a colorless liquid. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Boiling point approximately 140-145 C. Exhibits IR absorption for C-Cl (~600-500 cm??), C-Br (~600-500 cm??), and C-F groups (~1300-1100 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a chloro-trifluoromethoxy-bromo-substituted benzene, 2-chloro-4-(trifluoromethoxy)bromobenzene is predominantly utilized in the synthesis of biaryl-containing pharmaceuticals. It serves as a key intermediate in constructing biaryl scaffolds through Suzuki-Miyaura coupling reactions, where the bromo and chloro substituents provide valuable sites for cross-coupling as demonstrated in medicinal chemistry research (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its trifluoromethoxy group enhances solubility and binding affinity for target biomolecules (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyaryl ethers with enhanced flame retardancy, where the chloro, bromo, and trifluoromethoxy substituents contribute to improved fire-resistant characteristics (Polymer International).
Reviews
Write Your Own Review