2,6-dimethylphenyl isocyanate

2,6-dimethylphenyl isocyanate

2,6-difluoro-4-nitrotoluene

2,6-difluoro-4-nitrotoluene

2,6-dimethyl-3-nitroaniline

$300.00
CAS No.: 67083-28-7
Catalog No.: WLZ1616
Purity: 95%
MF: C8H10N2O2
MW: 166.18
Storage: 2-8 degree Celsius
SMILES: CC1=C(N)C(=CC=C1[N+](=O)[O-])C
Availability:
In stock
SKU
WLZ1616
  • Size
    Price
    Stock
    Estimated Shipping Time
CAS NO.: 67083-28-7; 2,6-dimethyl-3-nitroaniline. PROPERTIES: This aromatic amine features two methyl groups and a nitro group on a benzene ring, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The 2,6-dimethyl-3-nitroaniline typically appears as a colorless to pale yellow liquid with moderate solubility in common organic solvents. Its molecular structure includes electron-donating methyl groups and an electron-withdrawing nitro group that influence the electronic properties of the aromatic system. For optimal stability and to prevent oxidation of the amine group, this compound should be stored at 2-8 degree Celsius in an amber glass bottle under an inert atmosphere. When handling, appropriate safety measures including nitrile gloves and safety goggles are recommended. This compound is sensitive to light and oxygen, requiring careful environmental control during storage and use. In case of skin contact, wash thoroughly with soap and water; if eye contact occurs, rinse immediately and seek medical evaluation. APPLICATIONS: The 2,6-dimethyl-3-nitroaniline serves as a versatile building block in organic synthesis, particularly for creating methoxy-substituted bioactive molecules. The methyl groups provide a platform for further functionalization through reactions such as oxidation or alkylation. In medicinal chemistry, this compound functions as an intermediate for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The nitro group can be further reduced to amine functionality for additional diversification. Additionally, the molecule finds utility in materials science as a precursor for creating conductive polymers and other advanced materials where methoxy-containing moieties impart specific electronic properties. Researchers utilizing this compound can benefit from its functional group versatility, enabling the development of diverse molecular architectures for applications ranging from drug discovery to advanced materials.

Reviews

Write Your Own Review
You're reviewing:2,6-dimethyl-3-nitroaniline
Your Rating