2,4-dimethyl-6-nitroaniline
$400.00
CAS No.: 1635-84-3
Catalog No.: 190452
Purity: 95%
MF: C8H10N2O2
MW: 166.18
Storage: 2-8 degree Celsius
SMILES: CC1=C(N)C(=CC(=C1)C)[N+](=O)[O-]
Catalog No.: 190452
Purity: 95%
MF: C8H10N2O2
MW: 166.18
Storage: 2-8 degree Celsius
SMILES: CC1=C(N)C(=CC(=C1)C)[N+](=O)[O-]
2,4-dimethyl-6-nitroaniline; CAS No.: 1635-84-3; 2,4-dimethyl-6-nitroaniline. ChemShuttle, a prominent custom synthesis company, offers 2,4-dimethyl-6-nitroaniline (CAS No.: 1635-84-3) as part of its diverse Screening compounds collection. This compound is a valuable pharma building block used in the development of novel therapeutics. The company s expertise in process chemistry enables the efficient production of such specialized compounds, meeting the demands of pharmaceutical research. 2,4-dimethyl-6-nitroaniline serves as a crucial building block for drug discovery, highlighting ChemShuttle s commitment to providing high-quality chemical solutions for the pharmaceutical industry.
Reviews
Write Your Own Review