2,6-diiodo-4-nitroaniline
$180.00
CAS No.: 5398-27-6
Catalog No.: 189297
Purity: 95%
MF: C6H4I2N2O2
MW: 389.918
Storage: 2-8 degree Celsius
SMILES: IC1=C(N)C(=CC(=C1)[N+](=O)[O-])I
Catalog No.: 189297
Purity: 95%
MF: C6H4I2N2O2
MW: 389.918
Storage: 2-8 degree Celsius
SMILES: IC1=C(N)C(=CC(=C1)[N+](=O)[O-])I
2,6-diiodo-4-nitroaniline; CAS No.: 5398-27-6; 2,6-diiodo-4-nitroaniline is part of Chem Shuttle's collection of diiodonitroanilines that serve as key intermediates in organic synthesis. As a leading chemicals distributor, Chem Shuttle offers access to aniline derivatives with iodo, nitro, and amino substituents that are essential for the development of various pharmaceuticals and agrochemicals. This compound, with its diiodo and nitro groups, serves as a valuable building block for the synthesis of bioactive molecules with specific receptor affinities. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the discovery of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity 2,6-diiodo-4-nitroaniline, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review