1,5-dichloro-2-fluoro-4-nitrobenzene
$300.00
CAS No.: 2105-59-1
Catalog No.: 189298
Purity: 95%
MF: C6H2Cl2FNO2
MW: 209.991
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C(=C1)Cl)[N+](=O)[O-])F
Catalog No.: 189298
Purity: 95%
MF: C6H2Cl2FNO2
MW: 209.991
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C(=C1)Cl)[N+](=O)[O-])F
1,5-dichloro-2-fluoro-4-nitrobenzene; CAS No.: 2105-59-1; 1,5-dichloro-2-fluoro-4-nitrobenzene belongs to Chem Shuttle's collection of dichlorofluoronitrobenzenes that serve as key intermediates in organic synthesis. As a custom chemical synthesis company, Chem Shuttle specializes in producing aromatic compounds with chloro, fluoro, and nitro substituents that are crucial for the development of various pharmaceuticals and agrochemicals. This compound, with its dichloro, fluoro, and nitro groups, is particularly valuable as a building block for the synthesis of bioactive molecules with specific spatial configurations. Chem Shuttle's online chemical store provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that 1,5-dichloro-2-fluoro-4-nitrobenzene is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review