2-(4-isopropylphenyl)acetic acid
$350.00
CAS No.: 4476-28-2
Catalog No.: 197075
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C1=CC=C(C=C1)CC(=O)O
Catalog No.: 197075
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(C)(C)C1=CC=C(C=C1)CC(=O)O
2-(4-isopropylphenyl)acetic acid; CAS No.: 4476-28-2; 2-(4-isopropylphenyl)acetic acid. PROPERTIES: This isopropyl-substituted phenylacetic acid features molecular formula C??H??O? with molecular weight 166.22 g/mol. It generally appears as a white crystalline powder. Soluble in polar protic solvents like methanol and water. Melting point approximately 100-105 C. Exhibits IR absorption for carboxylic acid (~2900-2500 cm??) and hydroxyl groups (~3300 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause mild skin irritation and serious eye damage; therefore, standard laboratory safety precautions including protective clothing and eye protection are recommended during handling. APPLICATIONS: As an isopropyl-substituted phenylacetic acid, 2-(4-isopropylphenyl)acetic acid is predominantly utilized in the synthesis of beta-blockers. It serves as a key intermediate in constructing the characteristic arylacetic acid portion of these compounds, where the isopropyl group provides valuable binding affinity for beta-adrenergic receptors as demonstrated in medicinal chemistry research (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its carboxylic acid functionality enables conjugation to biomolecules via amide bond formation (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the isopropyl substituent contributes to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review