2,4-difluoro-6-nitroaniline
$350.00
CAS No.: 364-30-7
Catalog No.: 190579
Purity: 95%
MF: C6H4F2N2O2
MW: 174.106
Storage: 2-8 degree Celsius
SMILES: FC1=C(N)C(=CC(=C1)F)[N+](=O)[O-]
Catalog No.: 190579
Purity: 95%
MF: C6H4F2N2O2
MW: 174.106
Storage: 2-8 degree Celsius
SMILES: FC1=C(N)C(=CC(=C1)F)[N+](=O)[O-]
2,4-difluoro-6-nitroaniline; CAS No.: 364-30-7; 2,4-difluoro-6-nitroaniline. ChemShuttle, a leading chemical online store, provides a wide range of chemical building blocks such as 2,4-difluoro-6-nitroaniline (CAS No.: 364-30-7). This compound is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The company s custom chemical synthesis services allow for the production of such specialized compounds, catering to the unique requirements of researchers and industries. As a worldwide chemical supplier, ChemShuttle ensures the availability of high-quality chemical building blocks like 2,4-difluoro-6-nitroaniline, supporting advancements in chemical research and drug discovery.
Reviews
Write Your Own Review