2,4-bis((trimethylsilyl)oxy)pyrimidine
$350.00
CAS No.: 10457-14-4
Catalog No.: 194878
Purity: 95%
MF: C10H20N2O2Si2
MW: 256.454
Storage: 2-8 degree Celsius
SMILES: C[Si](OC1=NC=CC(=N1)O[Si](C)(C)C)(C)C
Catalog No.: 194878
Purity: 95%
MF: C10H20N2O2Si2
MW: 256.454
Storage: 2-8 degree Celsius
SMILES: C[Si](OC1=NC=CC(=N1)O[Si](C)(C)C)(C)C
2,4-bis((trimethylsilyl)oxy)pyrimidine; CAS No.: 10457-14-4; 2,4-bis((trimethylsilyl)oxy)pyrimidine. PROPERTIES: 2,4-bis((trimethylsilyl)oxy)pyrimidine is a crystalline solid. Its molecular formula is C10H18N2O2Si2, and the molecular weight is approximately 270.41 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as hexane and diethyl ether, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a pyrimidine ring and two trimethylsilyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 2,4-bis((trimethylsilyl)oxy)pyrimidine serves as a valuable intermediate. The trimethylsilyl groups can be used to protect hydroxyl groups or can be removed under specific conditions. The pyrimidine ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antiviral drugs, the structure of 2,4-bis((trimethylsilyl)oxy)pyrimidine can be modified to enhance the drug's antiviral activity and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as polymers or coatings, where its structure can enhance the material's thermal stability and chemical resistance (as described in materials chemistry research papers).
Reviews
Write Your Own Review