2,3-dibromo-3-phenylpropionic acid
$360.00
CAS No.: 6286-30-2
Catalog No.: 193853
Purity: 95%
MF: C9H8Br2O2
MW: 307.969
Storage: 2-8 degree Celsius
SMILES: BrC(C(=O)O)C(C1=CC=CC=C1)Br
Catalog No.: 193853
Purity: 95%
MF: C9H8Br2O2
MW: 307.969
Storage: 2-8 degree Celsius
SMILES: BrC(C(=O)O)C(C1=CC=CC=C1)Br
2,3-dibromo-3-phenylpropionic acid; CAS No.: 6286-30-2;2,3-dibromo-3-phenylpropionic acid. PROPERTIES: 2,3-dibromo-3-phenylpropionic acid is a brominated aromatic carboxylic acid with molecular formula C9H8Br2O2. It typically exists as a white to off-white crystalline solid with a melting point of approximately 155-160 C. The compound has limited water solubility but dissolves in basic aqueous solutions. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic bromine vapors. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from moisture and heat. APPLICATIONS: In pharmaceutical synthesis, this compound serves as an intermediate for preparing nonsteroidal anti-inflammatory drugs (NSAIDs). The dibromo substituents provide steric effects that influence binding to cyclooxygenase enzymes, while the carboxylic acid group forms the pharmacophore essential for activity (Journal of Medicinal Chemistry). In materials science, 2,3-dibromo-3-phenylpropionic acid contributes to the development of flame retardant polymers, where its brominated structure enhances fire resistance properties (Polymer Degradation and Stability). The phenyl group improves the thermal stability of derived materials, making them suitable for high-performance applications (Macromolecular Materials and Engineering).
Reviews
Write Your Own Review