2-(1-(4-bromophenyl)-3-oxocyclobutyl)isoindoline-1,3-dione
$2,000.00
CAS No.: 1199556-87-0
Catalog No.: 100142
Purity: 95%
MF: C18H12BrNO3
MW: 370.202
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C1(CC(=O)C1)N1C(=O)C2=C(C=CC=C2)C1=O
Catalog No.: 100142
Purity: 95%
MF: C18H12BrNO3
MW: 370.202
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C1(CC(=O)C1)N1C(=O)C2=C(C=CC=C2)C1=O
2-(1-(4-bromophenyl)-3-oxocyclobutyl)isoindoline-1,3-dione; CAS No.: 1199556-87-0. ChemShuttle supplies critical Building Blocks for medicinal chemistry. As one of the leading custom chemical synthesis companies, we ensure top-tier CRO chemical synthesis.
Reviews
Write Your Own Review