4-ethynyl-N,N-diphenylaniline

4-ethynyl-N,N-diphenylaniline

4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid

4-hydroxy-5-((2-hydroxybenzylidene)amino)naphthalene-2,7-disulfonic acid

1-(methylsulfonyl)-1H-benzotriazole

$200.00
CAS No.: 37073-15-7
Catalog No.: 194914
Purity: 95%
MF: C7H7N3O2S
MW: 197.219
Storage: 2-8 degree Celsius
SMILES: CS(=O)(=O)N1N=NC2=C1C=CC=C2
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194914
  • Size
    Price
    Stock
    Estimated Shipping Time
1-(methylsulfonyl)-1H-benzotriazole; CAS No.: 37073-15-7; 1-(methylsulfonyl)-1H-benzotriazole. PROPERTIES: 1-(methylsulfonyl)-1H-benzotriazole is a crystalline solid. Its molecular formula is C7H7N3O2S, and the molecular weight is approximately 197.21 g/mol. The compound has a melting point of approximately 120-122 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a benzotriazole ring and a methylsulfonyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1-(methylsulfonyl)-1H-benzotriazole serves as a valuable intermediate. The methylsulfonyl group can undergo various reactions such as hydrolysis and alkylation. The benzotriazole ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 1-(methylsulfonyl)-1H-benzotriazole can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:1-(methylsulfonyl)-1H-benzotriazole
Your Rating