1-bromo-2,3,5-trichlorobenzene
$250.00
CAS No.: 81067-38-1
Catalog No.: 190734
Purity: 95%
MF: C6H2BrCl3
MW: 260.345
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=CC(=C1)Cl)Cl)Cl
Catalog No.: 190734
Purity: 95%
MF: C6H2BrCl3
MW: 260.345
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=CC(=C1)Cl)Cl)Cl
1-bromo-2,3,5-trichlorobenzene; CAS No.: 81067-38-1; 1-bromo-2,3,5-trichlorobenzene is a representative of ChemShuttle's chem blocks, particularly valuable as a key intermediate in the synthesis of various specialized chemicals and pharmaceuticals. This polychlorinated benzene derivative with a bromine substituent offers multiple points of reactivity, making it a versatile starting material for constructing complex molecular architectures. ChemShuttle's role as a custom chemical synthesis company is highlighted by their ability to produce 1-bromo-2,3,5-trichlorobenzene (CAS No.: 81067-38-1) with consistent quality and reliability. As a leading chemicals distributor, ChemShuttle ensures the availability of this compound to research institutions and industrial laboratories worldwide. Their expertise in blocks chemistry ensures that researchers have access to high-quality intermediates essential for advancing chemical research and development across multiple disciplines.
Reviews
Write Your Own Review