2-Nitro-4-trifluoromethyl-benzoyl chloride
$200.00
CAS No.: 81108-81-8
Catalog No.: 190735
Purity: 95%
MF: C8H3ClF3NO3
MW: 253.563
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=C(C(=O)Cl)C=CC(=C1)C(F)(F)F
Catalog No.: 190735
Purity: 95%
MF: C8H3ClF3NO3
MW: 253.563
Storage: 2-8 degree Celsius
SMILES: [N+](=O)([O-])C1=C(C(=O)Cl)C=CC(=C1)C(F)(F)F
2-Nitro-4-trifluoromethyl-benzoyl chloride; CAS No.: 81108-81-8; 2-Nitro-4-trifluoromethyl-benzoyl chloride is part of ChemShuttle's extensive library of compounds designed for advanced chemical synthesis and drug discovery applications. This nitro-substituted trifluoromethyl aromatic derivative combines electrophilic character with fluorinated functionality, offering unique reactivity profiles valuable in constructing complex molecules. ChemShuttle's commitment to providing building blocks for drug discovery ensures that 2-nitro-4-trifluoromethyl-benzoyl chloride (CAS No.: 81108-81-8) meets the stringent quality requirements necessary for medicinal chemistry research. As a custom synthesis company, ChemShuttle can produce this compound in various quantities and purities, catering to specific project needs. Researchers benefit from the company's expertise in various organic chemicals, which ensures the availability of high-quality intermediates essential for developing novel pharmaceuticals and chemical entities with optimized properties.
Reviews
Write Your Own Review