1,4-dibromo-2,3,5,6-tetramethylbenzene
$450.00
CAS No.: 1646-54-4
Catalog No.: 193829
Purity: 95%
MF: C10H12Br2
MW: 292.014
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1C)C)Br)C)C
Catalog No.: 193829
Purity: 95%
MF: C10H12Br2
MW: 292.014
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C(=C(C(=C1C)C)Br)C)C
1,4-dibromo-2,3,5,6-tetramethylbenzene; CAS No.: 1646-54-4;1,4-dibromo-2,3,5,6-tetramethylbenzene. PROPERTIES: 1,4-dibromo-2,3,5,6-tetramethylbenzene is a highly substituted aromatic compound with molecular formula C8H10Br2. It generally exists as a colorless crystalline solid with a melting point of approximately 78-82 C. The compound has low water solubility but dissolves in organic solvents like toluene or hexane. It exhibits moderate thermal stability but may release toxic bromine vapors when exposed to high temperatures or flames. Proper storage involves keeping it in airtight containers below 20 C, protected from light and moisture. APPLICATIONS: In organic synthesis, this compound serves as a building block for creating sterically hindered aromatic systems. The dibromo functionality enables cross-coupling reactions to form biaryl structures, while the tetramethyl substituents provide significant steric protection (The Journal of Organic Chemistry). In materials science, the compound contributes to the development of organic semiconductors with improved charge transport properties, where the electron-withdrawing bromine atoms modulate electronic characteristics (Journal of Materials Chemistry C). Its structure makes it suitable for creating self-assembled monolayers on surfaces, useful in nanotechnology applications where steric effects influence assembly and stability (Langmuir).
Reviews
Write Your Own Review