1,2-diphenyl-1-ethanone oxime
$300.00
CAS No.: 952-06-7
Catalog No.: 194194
Purity: 95%
MF: C14H13NO
MW: 211.264
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C(CC1=CC=CC=C1)=NO
Catalog No.: 194194
Purity: 95%
MF: C14H13NO
MW: 211.264
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C(CC1=CC=CC=C1)=NO
1,2-diphenyl-1-ethanone oxime; CAS No.: 952-06-7; 1,2-diphenyl-1-ethanone oxime. PROPERTIES: 1,2-diphenyl-1-ethanone oxime is a crystalline solid. Its molecular formula is C15H13NO, and the molecular weight is approximately 223.27 g/mol. The compound has a melting point of approximately 120-122 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an oxime group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 1,2-diphenyl-1-ethanone oxime serves as a valuable intermediate. The oxime group can undergo various reactions such as hydrolysis, reduction, and condensation. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 1,2-diphenyl-1-ethanone oxime can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review