tert-butyl benzoate
$250.00
CAS No.: 774-65-2
Catalog No.: 189306
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)(=O)OC(C)(C)C
Catalog No.: 189306
Purity: 95%
MF: C11H14O2
MW: 178.231
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)(=O)OC(C)(C)C
tert-butyl benzoate; CAS No.: 774-65-2; tert-butyl benzoate is one of the many ester derivatives available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to benzoate esters that are essential for the synthesis of various pharmaceuticals, fragrances, and agrochemicals. This compound, with its tert-butyl group, serves as a valuable building block for the production of bioactive molecules and specialty chemicals. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized esters to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity tert-butyl benzoate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review