![3-chloro-[1,2,4]triazolo[4,3-a]pyridine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/170255_2.jpg)
tert-butyl ((4-(hydroxymethyl)piperidin-4-yl)methyl)carbamate
$450.00
CAS No.: 493026-47-4
Catalog No.: 170254
Purity: 95%
MF: C12H24N2O3
MW: 244.335
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NCC1(CO)CCNCC1
Catalog No.: 170254
Purity: 95%
MF: C12H24N2O3
MW: 244.335
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NCC1(CO)CCNCC1
tert-butyl ((4-(hydroxymethyl)piperidin-4-yl)methyl)carbamate; CAS No.: 493026-47-4; tert-butyl ((4-(hydroxymethyl)piperidin-4-yl)methyl)carbamate represents ChemShuttle's key intermediates for organic synthesis. As a custom chemical synthesis company, we provide protected piperidine derivatives with hydroxymethyl functionality for research. This compound combines a hydroxymethyl group with a tert-butyl carbamate-protected amine on a piperidine ring, providing unique steric properties. ChemShuttle's chemical synthesis expertise ensures precise substitution and high purity. The protected amine allows for controlled deprotection and further conjugation, making this compound valuable in peptide synthesis and medicinal chemistry.
Reviews
Write Your Own Review