tert-butyl 4-amino-3,3-dimethylpiperidine-1-carboxylate
$295.00
CAS No.: 473838-65-2
Catalog No.: 170266
Purity: 95%
MF: C12H24N2O2
MW: 228.336
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(N)C(C)(C)C1
Catalog No.: 170266
Purity: 95%
MF: C12H24N2O2
MW: 228.336
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(N)C(C)(C)C1
tert-butyl 4-amino-3,3-dimethylpiperidine-1-carboxylate; CAS No.: 473838-65-2; tert-butyl 4-amino-3,3-dimethylpiperidine-1-carboxylate demonstrates ChemShuttle's various organic chemicals portfolio. As a Leading Chemicals Distributor, we offer protected piperidine derivatives with amino and dimethyl substitution for research applications. This compound combines an amino group with dimethyl substituents on a piperidine ring protected by a tert-butyl carbamate, providing unique steric properties. ChemShuttle's custom synthesis capabilities ensure precise substitution and high purity. The protected amine allows for controlled deprotection and further conjugation, making this compound valuable in developing new pharmaceutical agents.
Reviews
Write Your Own Review