tert-butyl 4-(4-bromo-2-fluorophenyl)piperazine-1-carboxylate
$300.00
CAS No.: 1055120-85-8
Catalog No.: 190236
Purity: 95%
MF: C15H20BrFN2O2
MW: 359.239
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C=C1)N1CCN(CC1)C(=O)OC(C)(C)C)F
Catalog No.: 190236
Purity: 95%
MF: C15H20BrFN2O2
MW: 359.239
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=C(C=C1)N1CCN(CC1)C(=O)OC(C)(C)C)F
tert-butyl 4-(4-bromo-2-fluorophenyl)piperazine-1-carboxylate; CAS No.: 1055120-85-8; tert-butyl 4-(4-bromo-2-fluorophenyl)piperazine-1-carboxylate represents the bromofluorophenyl piperazines category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle provides access to piperazine derivatives with bromo and fluoro substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its bromo, fluoro, and piperazine groups, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that tert-butyl 4-(4-bromo-2-fluorophenyl)piperazine-1-carboxylate is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review