![1-[(2-fluorophenyl)methyl]-1H-pyrazol-5-amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171600_1.jpg)
tert-butyl 4-(3-amino-1H-pyrazol-5-yl)piperidine-1-carboxylate
$195.00
CAS No.: 1169563-99-8
Catalog No.: 171561
Purity: 95%
MF: C13H22N4O2
MW: 266.345
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(CC1)C1=CC(N)=NN1
Catalog No.: 171561
Purity: 95%
MF: C13H22N4O2
MW: 266.345
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCC(CC1)C1=CC(N)=NN1
tert-butyl 4-(3-amino-1H-pyrazol-5-yl)piperidine-1-carboxylate; CAS No.: 1169563-99-8; tert-butyl 4-(3-amino-1H-pyrazol-5-yl)piperidine-1-carboxylate is a various organic chemicals product offered by ChemShuttle, a leading chemicals distributor. It participates in small molecules synthesis, playing a role in the creation of diverse chemical substances. This compound provides a starting point for the synthesis of more complex molecules, enabling chemists to design and produce molecules with specific properties for different applications.
Reviews
Write Your Own Review