tert-butyl (4-(2,2,2-trifluoroacetamido)butyl)carbamate
$285.00
CAS No.: 811467-89-7
Catalog No.: 198388
Purity: 95%
MF: C11H19F3N2O3
MW: 284.278
Storage: 2-8 degree Celsius
SMILES: FC(C(=O)NCCCCNC(OC(C)(C)C)=O)(F)F
Catalog No.: 198388
Purity: 95%
MF: C11H19F3N2O3
MW: 284.278
Storage: 2-8 degree Celsius
SMILES: FC(C(=O)NCCCCNC(OC(C)(C)C)=O)(F)F
CAS No.:811467-89-7;tert-butyl (4-(2,2,2-trifluoroacetamido)butyl)carbamate;ChemShuttle distinguishes itself as a custom chemical synthesis company by providing unique building blocks such as the tert-butyl (4-(2,2,2-trifluoroacetamido)butyl)carbamate (CAS No.:811467-89-7). This compound combines the reactivity of a trifluoroacetamido group with the stability imparted by the tert-butyl carbamate, making it an excellent candidate for custom compound synthesis. As a chemical online mall, we recognize the growing demand for such specialized heterocycles in the pharmaceutical industry. The carbamate and trifluoroacetamido functionalities provide valuable points for chemical modification, while the butyl chain adds structural diversity. Researchers can benefit from our expertise in small molecules synthesis to produce this compound in the quantities needed for their experiments, supported by our full-time equivalent model that dedicates resources specifically to their projects.
Reviews
Write Your Own Review