![tert-butyl 6-bromo-2-oxo-1,2-dihydrospiro[indole-3,4'-piperidine]-1'-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171569_1.jpg)
![3-?oxaspiro[5.5]?undecan-?9-?one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171583_1.jpg)
tert-butyl 3-oxo-1-oxa-7-azaspiro[4.5]decane-7-carboxylate
$195.00
CAS No.: 1160246-89-8
Catalog No.: 171572
Purity: 95%
MF: C13H21NO4
MW: 255.314
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCCC2(CC(=O)CO2)C1
Catalog No.: 171572
Purity: 95%
MF: C13H21NO4
MW: 255.314
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CCCC2(CC(=O)CO2)C1
tert-butyl 3-oxo-1-oxa-7-azaspiro[4.5]decane-7-carboxylate; CAS No.: 1160246-89-8; tert-butyl 3-oxo-1-oxa-7-azaspiro[4.5]decane-7-carboxylate is a various organic chemicals product offered by ChemShuttle, a leading chemicals distributor. It participates in small molecules synthesis, playing a role in the creation of diverse chemical substances. This compound can be used as a starting material or intermediate in different chemical reactions, enabling the production of molecules with specific properties for various applications.
Reviews
Write Your Own Review