![3-methyl-3,9-diaza-spiro[5.5]undecane](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/5/150849_2.jpg)
![tert-butyl 5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171303_2.jpg)
tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride
$250.00
CAS No.: 236406-47-6
Catalog No.: 164082
Purity: 95%
MF: C14H27ClN2O2
MW: 290.835
Storage: 2-8 degree Celsius
SMILES: Cl.CC(C)(C)OC(=O)N1CCC2(CCNCC2)CC1
Catalog No.: 164082
Purity: 95%
MF: C14H27ClN2O2
MW: 290.835
Storage: 2-8 degree Celsius
SMILES: Cl.CC(C)(C)OC(=O)N1CCC2(CCNCC2)CC1
tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride; CAS No.: 236406-47-6; tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride is part of ChemShuttle's chemical building blocks collection, which includes a variety of chemical entities used in the synthesis of more complex molecules. As a chemical building block with potential applications in drug discovery, this compound highlights the company's ability to supply specialized building blocks for researchers. The chemical building blocks offered by ChemShuttle, such as tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride (CAS No.: 236406-47-6), are essential for the development of new pharmaceuticals. These chemical building blocks provide researchers with the necessary starting points to design and synthesize potential drug candidates. By offering a wide range of chemical building blocks, ChemShuttle supports the innovative efforts of scientists in the pharmaceutical industry. The tert-butyl 3,9-diazaspiro[5.5]undecane-3-carboxylate hydrochloride (CAS No.: 236406-47-6) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.
Reviews
Write Your Own Review