tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate
$225.00
CAS No.: 1629229-82-8
Catalog No.: 160307
Purity: 95%
MF: C10H18N2O3
MW: 214.265
Storage: 2-8 degree Celsius
SMILES: C[C@H]1N(CCNC1=O)C(=O)OC(C)(C)C
Catalog No.: 160307
Purity: 95%
MF: C10H18N2O3
MW: 214.265
Storage: 2-8 degree Celsius
SMILES: C[C@H]1N(CCNC1=O)C(=O)OC(C)(C)C
tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate; CAS No.: 1629229-82-8; tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate is part of ChemShuttle's chemical building blocks collection, which includes a variety of chemical entities used in the synthesis of more complex molecules. As a chemical building block with potential applications in drug discovery, this compound highlights the company's commitment to providing essential components for pharmaceutical research. The chemical building blocks offered by ChemShuttle, such as tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate (CAS No.: 1629229-82-8), are crucial for enabling scientists to construct molecules with desired biological activities. These chemical building blocks serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By supplying a diverse array of chemical building blocks, ChemShuttle ensures that researchers have access to the necessary components to advance their work. The tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate (CAS No.: 1629229-82-8) exemplifies the company's dedication to offering high-quality building blocks that contribute to innovation in chemical synthesis.
Reviews
Write Your Own Review