tert-butyl 2-methyl-4-oxopiperidine-1-carboxylate
$300.00
CAS No.: 190906-92-4
Catalog No.: 102781
Purity: 95%
MF: C11H19NO3
MW: 213.277
Storage: 2-8 degree Celsius
SMILES: CC1CC(=O)CCN1C(=O)OC(C)(C)C
Catalog No.: 102781
Purity: 95%
MF: C11H19NO3
MW: 213.277
Storage: 2-8 degree Celsius
SMILES: CC1CC(=O)CCN1C(=O)OC(C)(C)C
tert-butyl 2-methyl-4-oxopiperidine-1-carboxylate; CAS No.: 190906-92-4; ChemShuttle, a leading custom chemical synthesis company, offers a diverse range of chemical building blocks for drug discovery, including tert-butyl 2-methyl-4-oxopiperidine-1-carboxylate. This compound plays a crucial role in the synthesis of various pharmaceuticals, particularly in the development of antiviral and anticancer medications. As a chemical online store, ChemShuttle provides researchers and industries with access to an extensive library of compounds, ensuring they have the necessary resources for their projects. The company's expertise in chemical synthesis and its commitment to quality make it a reliable partner in advancing medical research and chemical applications.
Reviews
Write Your Own Review