3-bromo-5-(piperidin-2-yl)pyridine

3-bromo-5-(piperidin-2-yl)pyridine

1-benzyl-2,2-dimethylpiperidin-4-one hydrochloride

1-benzyl-2,2-dimethylpiperidin-4-one hydrochloride

tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate

$200.00
CAS No.: 741737-30-4
Catalog No.: 160352
Purity: 95%
MF: C11H19NO3
MW: 213.277
Storage: 2-8 degree Celsius
SMILES: CC1N(CCCC1=O)C(=O)OC(C)(C)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
160352
  • Size
    Price
    Stock
    Estimated Shipping Time
tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate; CAS No.: 741737-30-4; tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate is a chemical building block that plays a crucial role in the synthesis of more complex molecules. As a chemical building block with potential applications in drug discovery, this compound highlights the company's commitment to providing essential components for pharmaceutical research. The chemical building blocks offered by ChemShuttle, including tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate (CAS No.: 741737-30-4), are crucial for enabling researchers to construct complex molecules with potential therapeutic applications. These chemical building blocks serve as the foundation for numerous custom synthesis projects, facilitating the exploration of new chemical spaces in the quest for potential drug candidates. By offering a diverse array of chemical building blocks, ChemShuttle ensures that scientists have access to the necessary components to advance their research. The tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate (CAS No.: 741737-30-4) exemplifies the company's dedication to providing high-quality building blocks that contribute to innovation in chemical synthesis.

Reviews

Write Your Own Review
You're reviewing:tert-butyl 2-methyl-3-oxopiperidine-1-carboxylate
Your Rating