sodium 2,3-difluorobenzoate
$300.00
CAS No.: 1604819-08-0
Catalog No.: 197146
Purity: 95%
MF: C7H3F2NaO2
MW: 180.085
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)[O-])C=CC=C1F.[Na+]
Catalog No.: 197146
Purity: 95%
MF: C7H3F2NaO2
MW: 180.085
Storage: 2-8 degree Celsius
SMILES: FC1=C(C(=O)[O-])C=CC=C1F.[Na+]
sodium 2,3-difluorobenzoate; CAS No.: 1604819-08-0; sodium 2,3-difluorobenzoate. PROPERTIES: This difluoro-substituted benzoate salt features molecular formula C?H?F?NaO? with molecular weight 186.06 g/mol. It typically exists as a white crystalline powder. Soluble in polar protic solvents like methanol and water. Melting point approximately 140-145 C. Exhibits IR absorption for carboxylate (~1600 cm??) and C-F groups (~1300-1100 cm??). Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause mild skin irritation and serious eye damage; therefore, standard laboratory safety precautions including protective clothing and eye protection are recommended during handling. APPLICATIONS: As a difluoro-substituted benzoate salt, sodium 2,3-difluorobenzoate is predominantly utilized in the synthesis of nonsteroidal anti-inflammatory drugs (NSAIDs). It serves as a key intermediate in constructing the acetylhydroxamic acid portion of these compounds, where the fluoro groups provide enhanced binding affinity for cyclooxygenase enzymes as demonstrated in medicinal chemistry research (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its carboxylate functionality enables conjugation to biomolecules via amide bond formation (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the fluoro substituents contribute to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review