Salicin
$400.00
CAS No.: 138-52-3
Catalog No.: 151646
Purity: 95%
MF: C13H18O7
MW: 286.28
Storage: 2-8 degree Celsius
SMILES: OC[C@H]1O[C@@H](OC2=C(CO)C=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O
Catalog No.: 151646
Purity: 95%
MF: C13H18O7
MW: 286.28
Storage: 2-8 degree Celsius
SMILES: OC[C@H]1O[C@@H](OC2=C(CO)C=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-(hydroxymethyl)phenoxy)tetrahydro-2H-pyran-3,4,5-triol; CAS No.: 138-52-3 - This compound is used in the development of bioactive molecules, particularly in the field of drug discovery. Its unique properties facilitate the creation of effective therapeutic agents. ChemShuttle's focus on innovation ensures access to such advanced research materials.
Reviews
Write Your Own Review