(S)-4-oxo-piperidine-2-carboxylic acid hydrochloride
$435.00
CAS No.: 65060-18-6
Catalog No.: 172168
Purity: 95%
MF: C6H10ClNO3
MW: 179.603
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)[C@@H]1CC(=O)CCN1
Catalog No.: 172168
Purity: 95%
MF: C6H10ClNO3
MW: 179.603
Storage: 2-8 degree Celsius
SMILES: Cl.OC(=O)[C@@H]1CC(=O)CCN1
(S)-4-oxo-piperidine-2-carboxylic acid hydrochloride; CAS No.: 65060-18-6; (S)-4-oxo-piperidine-2-carboxylic acid hydrochloride is a heterocycle and a key intermediate. ChemShuttle, a chemical synthesis company, offers small molecules synthesis services for this compound. Their technical expertise allows for the accurate synthesis of this key intermediate. This heterocyclic compound can be used in many chemical synthesis processes, and ChemShuttle's services support the development of related chemical products.
Reviews
Write Your Own Review