(S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid
$200.00
CAS No.: 62965-10-0
Catalog No.: 189204
Purity: 95%
MF: C14H19NO4
MW: 265.309
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC(=O)N[C@H](C(=O)O)C(C)(C)C
Catalog No.: 189204
Purity: 95%
MF: C14H19NO4
MW: 265.309
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)OC(=O)N[C@H](C(=O)O)C(C)(C)C
(S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid; CAS No.: 62965-10-0; (S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid exemplifies the protected amino acid building blocks category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle provides access to amino acid derivatives with benzyloxycarbonyl protection that are crucial for solid-phase peptide synthesis and other applications requiring temporary protection of amino groups. This compound, with its benzyloxycarbonyl and dimethyl substituents, is particularly valuable as a building block for the production of bioactive peptides and pharmaceuticals. Chem Shuttle's custom compound synthesis services allow for the production of such specialized amino acids to exact specifications, supporting the development of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity (S)-2-(((benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid, facilitating advancements in peptide chemistry and drug development.
Reviews
Write Your Own Review