(S)-2-amino-3-(4-nitrophenyl)propanoic acid
$300.00
CAS No.: 949-99-5
Catalog No.: 134501
Purity: 95%
MF: C9H10N2O4
MW: 210.189
Storage: 2-8 degree Celsius
SMILES: N[C@@H](CC1=CC=C(C=C1)[N+]([O-])=O)C(O)=O
Catalog No.: 134501
Purity: 95%
MF: C9H10N2O4
MW: 210.189
Storage: 2-8 degree Celsius
SMILES: N[C@@H](CC1=CC=C(C=C1)[N+]([O-])=O)C(O)=O
(S)-2-amino-3-(4-nitrophenyl)propanoic acid; CAS No.: 949-99-5; (S)-2-amino-3-(4-nitrophenyl)propanoic acid is categorized under chemical building blocks, playing a significant role in the development of new pharmaceuticals and materials. ChemShuttle, as a chemical synthesis company, provides this compound as part of its extensive library of compounds. The company's custom synthesis capabilities allow for the production of CAS No.: 949-99-5; (S)-2-amino-3-(4-nitrophenyl)propanoic acid to meet specific research requirements, ensuring high quality and purity. As a leading chemicals distributor, ChemShuttle ensures that this building block is accessible to researchers worldwide, supporting advancements in drug discovery. The company's commitment to excellence in providing chemical building blocks underscores the importance of CAS No.: 949-99-5; (S)-2-amino-3-(4-nitrophenyl)propanoic acid in scientific innovation.
Reviews
Write Your Own Review