(S)-2-amino-3-(4-((fluorosulfonyl)oxy)phenyl)propanoic acid 2,2,2-trifluoroacetic acid
$250.00
CAS No.: 2580097-44-3
Catalog No.: 191496
Purity: 95%
MF: C11H11F4NO7S
MW: 377.268
Storage: 2-8 degree Celsius
SMILES: FC(C(=O)O)(F)F.N[C@H](C(=O)O)CC1=CC=C(C=C1)OS(=O)(=O)F
Catalog No.: 191496
Purity: 95%
MF: C11H11F4NO7S
MW: 377.268
Storage: 2-8 degree Celsius
SMILES: FC(C(=O)O)(F)F.N[C@H](C(=O)O)CC1=CC=C(C=C1)OS(=O)(=O)F
(S)-2-amino-3-(4-((fluorosulfonyl)oxy)phenyl)propanoic acid 2,2,2-trifluoroacetic acid; CAS No.: 2580097-44-3. As one of the leading custom chemical synthesis companies. ChemShuttle offers CRO chemical synthesis services for specialized building blocks like (S)-2-amino-3-(4-((fluorosulfonyl)oxy)phenyl)propanoic acid 2,2,2-trifluoroacetic acid, supporting drug discovery and development.
Reviews
Write Your Own Review