(S)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate
$500.00
CAS No.: 314741-39-4
Catalog No.: 136628
Purity: 95%
MF: C11H20N2O4
MW: 244.291
Storage: 2-8 degree Celsius
SMILES: COC(=O)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C
Catalog No.: 136628
Purity: 95%
MF: C11H20N2O4
MW: 244.291
Storage: 2-8 degree Celsius
SMILES: COC(=O)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C
(S)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate; CAS No.: 314741-39-4; (S)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate is categorized under chemical building blocks, playing a significant role in the development of new pharmaceuticals and materials. ChemShuttle, as a chemical synthesis company, provides this compound as part of its extensive library of compounds. The company's custom synthesis capabilities allow for the production of CAS No.: 314741-39-4; (S)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate to meet specific research requirements, ensuring high quality and purity. As a leading chemicals distributor, ChemShuttle ensures that this building block is accessible to researchers worldwide, supporting advancements in drug discovery. The company's commitment to excellence in providing chemical building blocks underscores the importance of CAS No.: 314741-39-4; (S)-1-tert-butyl 3-methyl piperazine-1,3-dicarboxylate in scientific innovation. ChemShuttle's extensive library of chemical building blocks includes this compound, which plays a crucial role in the development of new pharmaceuticals and materials.
Reviews
Write Your Own Review