(S)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride
$668.00
CAS No.: 2089671-12-3
Catalog No.: 189556
Purity: 95%
MF: C7H7BrClF3N2
MW: 291.498
Storage: 2-8 degree Celsius
SMILES: Cl.BrC1=NC=CC(=C1)[C@@H](C(F)(F)F)N
Catalog No.: 189556
Purity: 95%
MF: C7H7BrClF3N2
MW: 291.498
Storage: 2-8 degree Celsius
SMILES: Cl.BrC1=NC=CC(=C1)[C@@H](C(F)(F)F)N
(S)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride; CAS No.: 2089671-12-3; ChemShuttle specializes in building blocks for drug discovery, offering high-quality intermediates like (S)-1-(2-bromopyridin-4-yl)-2,2,2-trifluoroethan-1-amine hydrochloride. As a chemical synthesis company, we provide custom synthesis services to support pharmaceutical and biotech research, ensuring precise and scalable production of specialized compounds for medicinal chemistry applications.
Reviews
Write Your Own Review