4-cyanopiperidine

4-cyanopiperidine

rel-(2S,4S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-(tert-butoxycarbonyl)piperidine-2-carboxylic acid

rel-(2S,4S)-4-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-(tert-butoxycarbonyl)piperidine-2-carboxylic acid

rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate

$400.00
CAS No.: 1246442-45-4
Catalog No.: 194459
Purity: 95%
MF: C12H21NO5
MW: 259.302
Storage: 2-8 degree Celsius
SMILES: O[C@H]1C[C@H](CN(C1)C(=O)OC(C)(C)C)C(=O)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194459
  • Size
    Price
    Stock
    Estimated Shipping Time
rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate; CAS No.: 1246442-45-4; rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate. PROPERTIES: rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate is a crystalline solid. Its molecular formula is C11H19NO5, and the molecular weight is approximately 241.28 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a piperidine ring, a hydroxyl group, and a dicarboxylate group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, this compound serves as a valuable intermediate. The hydroxyl group can undergo reactions such as etherification and esterification. The piperidine ring and dicarboxylate groups provide opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:rel-1-(tert-butyl) 3-methyl (3R,5S)-5-hydroxypiperidine-1,3-dicarboxylate
Your Rating