S1RA; E-52862
$300.00
CAS No.: 878141-96-9
Catalog No.: 111958
Purity: 95%
MF: C20H23N3O2
MW: 337.423
Storage: 2-8 degree Celsius
SMILES: CC1=CC(OCCN2CCOCC2)=NN1C1=CC=C2C=CC=CC2=C1
Catalog No.: 111958
Purity: 95%
MF: C20H23N3O2
MW: 337.423
Storage: 2-8 degree Celsius
SMILES: CC1=CC(OCCN2CCOCC2)=NN1C1=CC=C2C=CC=CC2=C1
4-(2-((5-methyl-1-(naphthalen-2-yl)-1H-pyrazol-3-yl)oxy)ethyl)morpholine; CAS No.: 878141-96-9; This compound serves as an essential intermediate in the production of bioactive molecules, especially in the development of therapeutic agents. Its unique chemical properties facilitate the synthesis of complex heterocyclic structures, making it a valuable asset in medicinal chemistry. ChemShuttle provides this product as part of its extensive catalog, ensuring quick and reliable delivery from U.S. based warehouses.
Reviews
Write Your Own Review