BLU-285/Avapritinib
$325.00
CAS No.: 1703793-34-3
Catalog No.: 181951
Purity: 95%
MF: C26H27FN10
MW: 498.57
Storage: 2-8 degree Celsius
SMILES: CN1C=C(C=N1)C1=CN2N=CN=C(N3CCN(CC3)C3=NC=C(C=N3)[C@@](C)(N)C3=CC=C(F)C=C3)C2=C1
Catalog No.: 181951
Purity: 95%
MF: C26H27FN10
MW: 498.57
Storage: 2-8 degree Celsius
SMILES: CN1C=C(C=N1)C1=CN2N=CN=C(N3CCN(CC3)C3=NC=C(C=N3)[C@@](C)(N)C3=CC=C(F)C=C3)C2=C1
(S)-1-(4-fluorophenyl)-1-(2-(4-(6-(1-methyl-1H-pyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazin-4-yl)piperazin-1-yl)pyrimidin-5-yl)ethanamine; CAS No.: 1703793-34-3; Specializing in heterocycles, ChemShuttle is a leading chemical synthesis company. These compounds are widely used in medicinal chemistry and drug discovery due to their unique structural properties. Our custom synthesis services ensure that we can provide tailored solutions to meet the specific needs of our clients, driving innovation in the field.
Reviews
Write Your Own Review