PF-01247324
$150.00
CAS No.: 875051-72-2
Catalog No.: 133786
Purity: 95%
MF: C13H10Cl3N3O
MW: 330.602
Storage: 2-8 degree Celsius
SMILES: CNC(=O)C1=CC=C(C(N)=N1)C1=C(Cl)C(Cl)=CC(Cl)=C1
Catalog No.: 133786
Purity: 95%
MF: C13H10Cl3N3O
MW: 330.602
Storage: 2-8 degree Celsius
SMILES: CNC(=O)C1=CC=C(C(N)=N1)C1=C(Cl)C(Cl)=CC(Cl)=C1
6-amino-N-methyl-5-(2,3,5-trichlorophenyl)picolinamide; CAS No.: 875051-72-2 A key ingredient in pharmaceutical formulations, this chemical is known for its bioavailability. ChemShuttle s local R&D and US warehouse ensure consistent quality and timely delivery.
Reviews
Write Your Own Review