Oridonin
$200.00
CAS No.: 28957-04-2
Catalog No.: 151639
Purity: 95%
MF: C20H28O6
MW: 364.438
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CC[C@@H]3[C@@H](O)[C@]1(C(=O)C3=C)[C@]1(O)OC[C@]22[C@@H](O)CCC(C)(C)[C@@]2([H])[C@@H]1O
Catalog No.: 151639
Purity: 95%
MF: C20H28O6
MW: 364.438
Storage: 2-8 degree Celsius
SMILES: [H][C@@]12CC[C@@H]3[C@@H](O)[C@]1(C(=O)C3=C)[C@]1(O)OC[C@]22[C@@H](O)CCC(C)(C)[C@@]2([H])[C@@H]1O
Oridonin; CAS No.: 28957-04-2 - This bioactive compound is utilized in the synthesis of therapeutic agents, offering potential benefits in treating various diseases. ChemShuttle's commitment to providing high-quality bioactive compounds enhances its value in pharmaceutical research.
Reviews
Write Your Own Review