Loureirin D
$540.00
CAS No.: 119425-91-1
Catalog No.: ZB1868
Purity: 95%
MF: C16H16O5
MW: 288.299
Storage: 2-8 degree Celsius
SMILES: OC1=C(C(=CC(=C1)O)OC)CCC(=O)C1=CC=C(C=C1)O
Catalog No.: ZB1868
Purity: 95%
MF: C16H16O5
MW: 288.299
Storage: 2-8 degree Celsius
SMILES: OC1=C(C(=CC(=C1)O)OC)CCC(=O)C1=CC=C(C=C1)O
Loureirin D; 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one; CAS No.: 119425-91-1; Being a custom chemical synthesis company, ChemShuttle specializes in providing key intermediates for drug discovery, including the compound 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one. This heterocycle is of significant interest in the pharmaceutical industry due to its potential as a lead compound in the development of new medications. ChemShuttle's expertise in Small molecules synthesis allows for the efficient production of this compound with high purity and reliability. As a worldwide chemical supplier, the company ensures that researchers and industries have access to this crucial building block, facilitating advancements in drug discovery and chemical research. Through their comprehensive Library of Compounds and commitment to quality, ChemShuttle continues to be a valuable resource for the scientific community.
Reviews
Write Your Own Review