Hederagenin
$320.00
CAS No.: 465-99-6
Catalog No.: ZB1857
Purity: 95%
MF: C30H48O4
MW: 472.71
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1[C@@]([C@@H]2CC[C@]3([C@@]4(CC[C@]5(CCC(C[C@H]5C4=CCC3[C@]2(CC1)C)(C)C)C(=O)O)C)C)(C)CO
Catalog No.: ZB1857
Purity: 95%
MF: C30H48O4
MW: 472.71
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1[C@@]([C@@H]2CC[C@]3([C@@]4(CC[C@]5(CCC(C[C@H]5C4=CCC3[C@]2(CC1)C)(C)C)C(=O)O)C)C)(C)CO
Hederagenin; (4aS,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid; CAS No.: 465-99-6; (4aS,6aS,6bR,8aR,9R,10S,12aR,14bS)-10-Hydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid is an extremely complex cycle compound with multiple stereocenters and functional groups, characteristic of natural product synthesis targets. As a custom chemical synthesis company, ChemShuttle excels in producing highly complex molecules with intricate stereochemistry, offering clients the expertise needed to synthesize such challenging structures. The company s CRO chemical synthesis services ensure the production of this carboxylic acid with precise stereocontrol and high purity, essential for natural product total synthesis and biological evaluations. Its numerous methyl, hydroxyl, and carboxyl groups provide sites for diverse chemical transformations, while the polycyclic core mimics the architecture of bioactive natural products like terpenoids or steroids. ChemShuttle s capability in synthesizing such complex cycle compounds positions it as a leader in supporting advanced natural product research and drug discovery.
Reviews
Write Your Own Review