Graveoline
$750.00
CAS No.: 485-61-0
Catalog No.: ZB1720
Purity: 95%
MF: C17H13NO3
MW: 279.295
Storage: 2-8 degree Celsius
SMILES: O1COC2=C1C=CC(=C2)C=2N(C1=CC=CC=C1C(C2)=O)C
Catalog No.: ZB1720
Purity: 95%
MF: C17H13NO3
MW: 279.295
Storage: 2-8 degree Celsius
SMILES: O1COC2=C1C=CC(=C2)C=2N(C1=CC=CC=C1C(C2)=O)C
Graveoline; 2-(benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one; CAS No.: 485-61-0; 2-(Benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one is a heterocyclic compound with a quinoline core and a benzo[d][1,3]dioxolyl substituent, relevant in the synthesis of alkaloid-like molecules and potential drug candidates. As a worldwide chemical supplier, ChemShuttle provides access to this complex heterocycle, supporting researchers in exploring the biological activities of quinoline derivatives. The company s small molecules synthesis capabilities allow for the production of this compound with high purity, essential for biological assays and structure-activity relationship studies. Its dioxolane ring adds aromatic complexity, while the quinolinone moiety offers nitrogen-containing reactivity, making it suitable for synthesizing antimicrobial agents or enzyme inhibitors. ChemShuttle s role as a supplier of diverse heterocycles ensures that clients can access such structurally rich compounds to advance their drug discovery efforts.
Reviews
Write Your Own Review