Ch5447240
$4,446.00
CAS No.: 1253919-92-4
Catalog No.: TQR0476
Purity: 95%
MF: C26H39N5O4S
MW: 517.68
Storage: 2-8 degree Celsius
SMILES: O=C(N)N(C1=CC(C)=C(CCS(=O)(N(CC2)CCC2(N=C([C@H]3CC[C@H](C)CC3)N4)C4=O)=O)C(C)=C1)C
Catalog No.: TQR0476
Purity: 95%
MF: C26H39N5O4S
MW: 517.68
Storage: 2-8 degree Celsius
SMILES: O=C(N)N(C1=CC(C)=C(CCS(=O)(N(CC2)CCC2(N=C([C@H]3CC[C@H](C)CC3)N4)C4=O)=O)C(C)=C1)C
CAS NO.:1253919-92-4; Ch5447240 is a fluorescent chemical building block for probe development. ChemShuttle, a chemical synthesis company, provides this compound (CAS NO.:1253919-92-4) for imaging and diagnostic applications. As a chemical building block, it enables the creation of targeted fluorescent conjugates for cellular tracking. The company’s chemical synthesis company expertise ensures high-purity materials, supporting advanced research in molecular imaging and theranostics.
Reviews
Write Your Own Review