Ceftazidime Impurity A
$400.00
CAS No.: 1000980-60-8
Catalog No.: 190264
Purity: 95%
MF: C22H22N6O7S2
MW: 546.587
Storage: 2-8 degree Celsius
SMILES: N12[C@@]([H])([C@H](NC(/C(/C3=CSC(N)=N3)=N\OC(C(O)=O)(C)C)=O)C1=O)SC=C(C[N+]1=CC=CC=C1)C2C([O-])=O
Catalog No.: 190264
Purity: 95%
MF: C22H22N6O7S2
MW: 546.587
Storage: 2-8 degree Celsius
SMILES: N12[C@@]([H])([C@H](NC(/C(/C3=CSC(N)=N3)=N\OC(C(O)=O)(C)C)=O)C1=O)SC=C(C[N+]1=CC=CC=C1)C2C([O-])=O
Ceftazidime Impurity A; (6R,7R)-7-((Z)-2-(2-aminothiazol-4-yl)-2-(((2-carboxypropan-2-yl)oxy)imino)acetamido)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate; CAS No.: 1000980-60-8; (6R,7R)-7-((Z)-2-(2-aminothiazol-4-yl)-2-(((2-carboxypropan-2-yl)oxy)imino)acetamido)-8-oxo-3-(pyridin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate exemplifies the complex beta-lactam antibiotics category within Chem Shuttle's product range. As a custom chemical synthesis company, Chem Shuttle specializes in producing complex antibiotic structures that are crucial for the development of various pharmaceuticals with specific biological activities. This compound, with its multiple functional groups and chiral centers, serves as a valuable building block for the synthesis of bioactive molecules targeting specific enzymes and receptors. Chem Shuttle's online platform allows researchers to conveniently procure such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in small molecules synthesis ensures that this complex beta-lactam antibiotic is available in high purity and with precise specifications, making it a reliable tool for synthetic chemists.
Reviews
Write Your Own Review