(2S,3R,4S,5S,6R)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol
$200.00
CAS No.: 714269-57-5
Catalog No.: 186108
Purity: 95%
MF: C22H27ClO7
MW: 438.904
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)[C@@]1(O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO)OC)CC1=CC=C(C=C1)OCC
Catalog No.: 186108
Purity: 95%
MF: C22H27ClO7
MW: 438.904
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C=C(C=C1)[C@@]1(O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO)OC)CC1=CC=C(C=C1)OCC
(2S,3R,4S,5S,6R)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol; CAS No.: 714269-57-5; ChemShuttle's library includes (2S,3R,4S,5S,6R)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol, which is a valuable building block for pharmaceutical development. As a custom chemical synthesis company, it provides various organic chemicals and cycle compounds. Its collection of heterocycles and key intermediates serves as essential chem blocks for drug discovery, allowing researchers to access the necessary compounds for their projects.
Reviews
Write Your Own Review